C23H21BrN4O2S — CID 55812829
N-(5-bromo-2-pyridinyl)-1-(2-phenylsulfanylpyridine-3-carbonyl)piperidine-4-carboxamide (PubChem CID 55812829) has the molecular formula C23H21BrN4O2S and a molecular weight of 497.42 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-1-(2-phenylsulfanylpyridine-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-1-(2-phenylsulfanylpyridine-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55812829 |
| Molecular Formula | C23H21BrN4O2S |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-1-(2-phenylsulfanylpyridine-3-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cn1)C1CCN(C(=O)c2cccnc2Sc2ccccc2)CC1 |
| InChI | InChI=1S/C23H21BrN4O2S/c24-17-8-9-20(26-15-17)27-21(29)16-10-13-28(14-11-16)23(30)19-7-4-12-25-22(19)31-18-5-2-1-3-6-18/h1-9,12,15-16H,10-11,13-14H2,(H,26,27,29) |
| InChIKey | GEJXOTAYTAELRA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |