C18H15BrClF2N3O2 — CID 55930750
N-(5-bromo-2-pyridinyl)-1-(2-chloro-4,5-difluorobenzoyl)piperidine-4-carboxamide (PubChem CID 55930750) has the molecular formula C18H15BrClF2N3O2 and a molecular weight of 458.69 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-1-(2-chloro-4,5-difluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-1-(2-chloro-4,5-difluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55930750 |
| Molecular Formula | C18H15BrClF2N3O2 |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 457.00 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-1-(2-chloro-4,5-difluorobenzoyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cn1)C1CCN(C(=O)c2cc(F)c(F)cc2Cl)CC1 |
| InChI | InChI=1S/C18H15BrClF2N3O2/c19-11-1-2-16(23-9-11)24-17(26)10-3-5-25(6-4-10)18(27)12-7-14(21)15(22)8-13(12)20/h1-2,7-10H,3-6H2,(H,23,24,26) |
| InChIKey | HEFGRRCGLLSBCD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|