C18H16ClFIN3O2 — CID 55925189
N-(5-chloro-2-pyridinyl)-1-(4-fluoro-2-iodobenzoyl)piperidine-4-carboxamide (PubChem CID 55925189) has the molecular formula C18H16ClFIN3O2 and a molecular weight of 487.70 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-1-(4-fluoro-2-iodobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-1-(4-fluoro-2-iodobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55925189 |
| Molecular Formula | C18H16ClFIN3O2 |
| Molecular Weight | 487.70 g/mol |
| Exact Mass | 487.00 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-1-(4-fluoro-2-iodobenzoyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)C1CCN(C(=O)c2ccc(F)cc2I)CC1 |
| InChI | InChI=1S/C18H16ClFIN3O2/c19-12-1-4-16(22-10-12)23-17(25)11-5-7-24(8-6-11)18(26)14-3-2-13(20)9-15(14)21/h1-4,9-11H,5-8H2,(H,22,23,25) |
| InChIKey | DBHPAFIRALLODO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.70 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|