C19H23Cl3N4O2 — CID 120643954
1-(5-amino-2-methylbenzoyl)-N-(5-chloro-2-pyridinyl)piperidine-4-carboxamide;dihydrochloride (PubChem CID 120643954) has the molecular formula C19H23Cl3N4O2 and a molecular weight of 445.78 g/mol. Its IUPAC name is 1-(5-amino-2-methylbenzoyl)-N-(5-chloro-2-pyridinyl)piperidine-4-carboxamide;dihydrochloride.
| Compound Name | 1-(5-amino-2-methylbenzoyl)-N-(5-chloro-2-pyridinyl)piperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120643954 |
| Molecular Formula | C19H23Cl3N4O2 |
| Molecular Weight | 445.78 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 1-(5-amino-2-methylbenzoyl)-N-(5-chloro-2-pyridinyl)piperidine-4-carboxamide;dihydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)N1CCC(C(=O)Nc2ccc(Cl)cn2)CC1.Cl.Cl |
| InChI | InChI=1S/C19H21ClN4O2.2ClH/c1-12-2-4-15(21)10-16(12)19(26)24-8-6-13(7-9-24)18(25)23-17-5-3-14(20)11-22-17;;/h2-5,10-11,13H,6-9,21H2,1H3,(H,22,23,25);2*1H |
| InChIKey | JITMUEJCSIRQOM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.78 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|