C24H24ClFN4O2 — CID 55812719
N-(5-chloro-2-pyridinyl)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperidine-4-carboxamide (PubChem CID 55812719) has the molecular formula C24H24ClFN4O2 and a molecular weight of 454.93 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55812719 |
| Molecular Formula | C24H24ClFN4O2 |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]piperidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N2CCC(C(=O)Nc3ccc(Cl)cn3)CC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H24ClFN4O2/c1-15-13-21(16(2)30(15)20-6-4-19(26)5-7-20)24(32)29-11-9-17(10-12-29)23(31)28-22-8-3-18(25)14-27-22/h3-8,13-14,17H,9-12H2,1-2H3,(H,27,28,31) |
| InChIKey | NMOHDTZNHIBQLJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|