C23H29FN4O3 — CID 25333417
N'-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-1-(2-methylpropanoyl)piperidine-4-carbohydrazide (PubChem CID 25333417) has the molecular formula C23H29FN4O3 and a molecular weight of 428.51 g/mol. Its IUPAC name is N'-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-1-(2-methylpropanoyl)piperidine-4-carbohydrazide.
| Compound Name | N'-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-1-(2-methylpropanoyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 25333417 |
| Molecular Formula | C23H29FN4O3 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N'-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-1-(2-methylpropanoyl)piperidine-4-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)C2CCN(C(=O)C(C)C)CC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H29FN4O3/c1-14(2)23(31)27-11-9-17(10-12-27)21(29)25-26-22(30)20-13-15(3)28(16(20)4)19-7-5-18(24)6-8-19/h5-8,13-14,17H,9-12H2,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | GLMAXHOXHGWAQE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|