C23H24FN9O2 — CID 24664081
N'-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidine-4-carbohydrazide (PubChem CID 24664081) has the molecular formula C23H24FN9O2 and a molecular weight of 477.50 g/mol. Its IUPAC name is N'-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidine-4-carbohydrazide.
| Compound Name | N'-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 24664081 |
| Molecular Formula | C23H24FN9O2 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | N'-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-1-(tetrazolo[1,5-b]pyridazin-6-yl)piperidine-4-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)C2CCN(c3ccc4nnnn4n3)CC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H24FN9O2/c1-14-13-19(15(2)32(14)18-5-3-17(24)4-6-18)23(35)27-26-22(34)16-9-11-31(12-10-16)21-8-7-20-25-29-30-33(20)28-21/h3-8,13,16H,9-12H2,1-2H3,(H,26,34)(H,27,35) |
| InChIKey | CLRPRNMCPLNAPR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|