C23H30FN3O — CID 2432886
N'-[(4S)-4-tert-butylcyclohexen-1-yl]-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide (PubChem CID 2432886) has the molecular formula C23H30FN3O and a molecular weight of 383.51 g/mol. Its IUPAC name is N'-[(4S)-4-tert-butylcyclohexen-1-yl]-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide.
| Compound Name | N'-[(4S)-4-tert-butylcyclohexen-1-yl]-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 2432886 |
| Molecular Formula | C23H30FN3O |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | N'-[(4S)-4-tert-butylcyclohexen-1-yl]-1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC2=CC[C@@H](C(C)(C)C)CC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H30FN3O/c1-15-14-21(16(2)27(15)20-12-8-18(24)9-13-20)22(28)26-25-19-10-6-17(7-11-19)23(3,4)5/h8-10,12-14,17,25H,6-7,11H2,1-5H3,(H,26,28)/t17-/m1/s1 |
| InChIKey | AHVWOXPNGORABE-QGZVFWFLSA-N |
| XLogP | 5.20 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|