C20H26FN3O2 — CID 110654843
1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(2-morpholin-4-ylethylamino)ethanone (PubChem CID 110654843) has the molecular formula C20H26FN3O2 and a molecular weight of 359.45 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(2-morpholin-4-ylethylamino)ethanone.
| Compound Name | 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(2-morpholin-4-ylethylamino)ethanone |
|---|---|
| PubChem CID | 110654843 |
| Molecular Formula | C20H26FN3O2 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(2-morpholin-4-ylethylamino)ethanone |
| SMILES | Cc1cc(C(=O)CNCCN2CCOCC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H26FN3O2/c1-15-13-19(16(2)24(15)18-5-3-17(21)4-6-18)20(25)14-22-7-8-23-9-11-26-12-10-23/h3-6,13,22H,7-12,14H2,1-2H3 |
| InChIKey | PIXUSUGBLIOGDN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|