C27H30FN3O2 — CID 110659500
2-[4-(3,4-dimethylbenzoyl)piperazin-1-yl]-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 110659500) has the molecular formula C27H30FN3O2 and a molecular weight of 447.55 g/mol. Its IUPAC name is 2-[4-(3,4-dimethylbenzoyl)piperazin-1-yl]-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-[4-(3,4-dimethylbenzoyl)piperazin-1-yl]-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 110659500 |
| Molecular Formula | C27H30FN3O2 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 2-[4-(3,4-dimethylbenzoyl)piperazin-1-yl]-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | Cc1ccc(C(=O)N2CCN(CC(=O)c3cc(C)n(-c4ccc(F)cc4)c3C)CC2)cc1C |
| InChI | InChI=1S/C27H30FN3O2/c1-18-5-6-22(15-19(18)2)27(33)30-13-11-29(12-14-30)17-26(32)25-16-20(3)31(21(25)4)24-9-7-23(28)8-10-24/h5-10,15-16H,11-14,17H2,1-4H3 |
| InChIKey | FRSQEJABOFELKR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|