C25H25BrFN3O2 — CID 110659493
2-[4-(4-bromobenzoyl)piperazin-1-yl]-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 110659493) has the molecular formula C25H25BrFN3O2 and a molecular weight of 498.40 g/mol. Its IUPAC name is 2-[4-(4-bromobenzoyl)piperazin-1-yl]-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-[4-(4-bromobenzoyl)piperazin-1-yl]-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 110659493 |
| Molecular Formula | C25H25BrFN3O2 |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 2-[4-(4-bromobenzoyl)piperazin-1-yl]-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | Cc1cc(C(=O)CN2CCN(C(=O)c3ccc(Br)cc3)CC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H25BrFN3O2/c1-17-15-23(18(2)30(17)22-9-7-21(27)8-10-22)24(31)16-28-11-13-29(14-12-28)25(32)19-3-5-20(26)6-4-19/h3-10,15H,11-14,16H2,1-2H3 |
| InChIKey | UARINPLPCHPCPU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|