C28H32FN3O3 — CID 110659512
1-[4-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]piperazin-1-yl]-4-phenoxybutan-1-one (PubChem CID 110659512) has the molecular formula C28H32FN3O3 and a molecular weight of 477.58 g/mol. Its IUPAC name is 1-[4-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]piperazin-1-yl]-4-phenoxybutan-1-one.
| Compound Name | 1-[4-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]piperazin-1-yl]-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 110659512 |
| Molecular Formula | C28H32FN3O3 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 1-[4-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]piperazin-1-yl]-4-phenoxybutan-1-one |
| SMILES | Cc1cc(C(=O)CN2CCN(C(=O)CCCOc3ccccc3)CC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H32FN3O3/c1-21-19-26(22(2)32(21)24-12-10-23(29)11-13-24)27(33)20-30-14-16-31(17-15-30)28(34)9-6-18-35-25-7-4-3-5-8-25/h3-5,7-8,10-13,19H,6,9,14-18,20H2,1-2H3 |
| InChIKey | OGOPJHFZPJDPLE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|