C25H28N4O2 — CID 110659385
4-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]-N-phenylpiperazine-1-carboxamide (PubChem CID 110659385) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 4-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 110659385 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 4-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]-N-phenylpiperazine-1-carboxamide |
| SMILES | Cc1cc(C(=O)CN2CCN(C(=O)Nc3ccccc3)CC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C25H28N4O2/c1-19-17-23(20(2)29(19)22-11-7-4-8-12-22)24(30)18-27-13-15-28(16-14-27)25(31)26-21-9-5-3-6-10-21/h3-12,17H,13-16,18H2,1-2H3,(H,26,31) |
| InChIKey | HMLFUFBTKQTAHL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|