C24H33N3O2 — CID 110659419
1-[4-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]piperazin-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 110659419) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-[4-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]piperazin-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]piperazin-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 110659419 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 1-[4-[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl]piperazin-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | Cc1cc(C(=O)CN2CCN(C(=O)CC(C)(C)C)CC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C24H33N3O2/c1-18-15-21(19(2)27(18)20-9-7-6-8-10-20)22(28)17-25-11-13-26(14-12-25)23(29)16-24(3,4)5/h6-10,15H,11-14,16-17H2,1-5H3 |
| InChIKey | UVNRAAKUNIDKQD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|