C22H22N2O — CID 110654776
2-(2,3-dihydroindol-1-yl)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone (PubChem CID 110654776) has the molecular formula C22H22N2O and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 110654776 |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)CN2CCc3ccccc32)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H22N2O/c1-16-14-20(17(2)24(16)19-9-4-3-5-10-19)22(25)15-23-13-12-18-8-6-7-11-21(18)23/h3-11,14H,12-13,15H2,1-2H3 |
| InChIKey | ZACHBYIHEHFZGB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|