C10H10NO2- — CID 6935608
2-(2,3-dihydroindol-1-yl)acetate (PubChem CID 6935608) has the molecular formula C10H10NO2- and a molecular weight of 176.20 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)acetate.
| Compound Name | 2-(2,3-dihydroindol-1-yl)acetate |
|---|---|
| PubChem CID | 6935608 |
| Molecular Formula | C10H10NO2- |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)acetate |
| SMILES | O=C([O-])CN1CCc2ccccc21 |
| InChI | InChI=1S/C10H11NO2/c12-10(13)7-11-6-5-8-3-1-2-4-9(8)11/h1-4H,5-7H2,(H,12,13)/p-1 |
| InChIKey | ZYKYVZPUUGVMFE-UHFFFAOYSA-M |
| XLogP | -0.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |