C12H15N — CID 15723561
1-(2-methylprop-2-enyl)-2,3-dihydroindole (PubChem CID 15723561) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-2,3-dihydroindole.
| Compound Name | 1-(2-methylprop-2-enyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 15723561 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-2,3-dihydroindole |
| SMILES | C=C(C)CN1CCc2ccccc21 |
| InChI | InChI=1S/C12H15N/c1-10(2)9-13-8-7-11-5-3-4-6-12(11)13/h3-6H,1,7-9H2,2H3 |
| InChIKey | KKOKJQXCWIGNCX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|