C12H15NO2 — CID 174450799
2-(2,3-dihydroindol-1-yl)ethyl acetate (PubChem CID 174450799) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)ethyl acetate.
| Compound Name | 2-(2,3-dihydroindol-1-yl)ethyl acetate |
|---|---|
| PubChem CID | 174450799 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)ethyl acetate |
| SMILES | CC(=O)OCCN1CCc2ccccc21 |
| InChI | InChI=1S/C12H15NO2/c1-10(14)15-9-8-13-7-6-11-4-2-3-5-12(11)13/h2-5H,6-9H2,1H3 |
| InChIKey | ORXXPBLVYNUUNS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |