C10H14N2 — CID 1072384
2-(2,3-dihydroindol-1-yl)ethanamine (PubChem CID 1072384) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)ethanamine.
| Compound Name | 2-(2,3-dihydroindol-1-yl)ethanamine |
|---|---|
| PubChem CID | 1072384 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)ethanamine |
| SMILES | NCCN1CCc2ccccc21 |
| InChI | InChI=1S/C10H14N2/c11-6-8-12-7-5-9-3-1-2-4-10(9)12/h1-4H,5-8,11H2 |
| InChIKey | HNLHKBSAQALACU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |