C13H19N — CID 143815180
1-(3-methylbutyl)-2,3-dihydroindole (PubChem CID 143815180) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 1-(3-methylbutyl)-2,3-dihydroindole.
| Compound Name | 1-(3-methylbutyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 143815180 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1-(3-methylbutyl)-2,3-dihydroindole |
| SMILES | CC(C)CCN1CCc2ccccc21 |
| InChI | InChI=1S/C13H19N/c1-11(2)7-9-14-10-8-12-5-3-4-6-13(12)14/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | MNQFGRISFNDPKP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |