C10H14ClNO — CID 169005265
2-(2,3-dihydroindol-1-yl)ethanol;hydrochloride (PubChem CID 169005265) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)ethanol;hydrochloride.
| Compound Name | 2-(2,3-dihydroindol-1-yl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 169005265 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)ethanol;hydrochloride |
| SMILES | Cl.OCCN1CCc2ccccc21 |
| InChI | InChI=1S/C10H13NO.ClH/c12-8-7-11-6-5-9-3-1-2-4-10(9)11;/h1-4,12H,5-8H2;1H |
| InChIKey | VEGPFAACBXMEJU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |