C12H17N — CID 4167209
1-butyl-2,3-dihydroindole (PubChem CID 4167209) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is 1-butyl-2,3-dihydroindole.
| Compound Name | 1-butyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 4167209 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 1-butyl-2,3-dihydroindole |
| SMILES | CCCCN1CCc2ccccc21 |
| InChI | InChI=1S/C12H17N/c1-2-3-9-13-10-8-11-6-4-5-7-12(11)13/h4-7H,2-3,8-10H2,1H3 |
| InChIKey | SEOOBROTBJRSHG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |