C14H22N2O — CID 62569832
3-(2,3-dihydroindol-1-yl)-N-(2-methoxyethyl)propan-1-amine (PubChem CID 62569832) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)-N-(2-methoxyethyl)propan-1-amine.
| Compound Name | 3-(2,3-dihydroindol-1-yl)-N-(2-methoxyethyl)propan-1-amine |
|---|---|
| PubChem CID | 62569832 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)-N-(2-methoxyethyl)propan-1-amine |
| SMILES | COCCNCCCN1CCc2ccccc21 |
| InChI | InChI=1S/C14H22N2O/c1-17-12-9-15-8-4-10-16-11-7-13-5-2-3-6-14(13)16/h2-3,5-6,15H,4,7-12H2,1H3 |
| InChIKey | ATFYZLKRKLUAOM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|