C14H20N2 — CID 60867490
N-[3-(2,3-dihydroindol-1-yl)propyl]cyclopropanamine (PubChem CID 60867490) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)propyl]cyclopropanamine.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 60867490 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)propyl]cyclopropanamine |
| SMILES | c1ccc2c(c1)CCN2CCCNC1CC1 |
| InChI | InChI=1S/C14H20N2/c1-2-5-14-12(4-1)8-11-16(14)10-3-9-15-13-6-7-13/h1-2,4-5,13,15H,3,6-11H2 |
| InChIKey | STALKAHLKHRWHQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|