C18H27N3 — CID 105363806
N-[3-(2,3-dihydroindol-1-yl)propyl]-1-azabicyclo[3.2.1]octan-4-amine (PubChem CID 105363806) has the molecular formula C18H27N3 and a molecular weight of 285.43 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)propyl]-1-azabicyclo[3.2.1]octan-4-amine.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-1-azabicyclo[3.2.1]octan-4-amine |
|---|---|
| PubChem CID | 105363806 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-1-azabicyclo[3.2.1]octan-4-amine |
| SMILES | c1ccc2c(c1)CCN2CCCNC1CCN2CCC1C2 |
| InChI | InChI=1S/C18H27N3/c1-2-5-18-15(4-1)7-13-21(18)10-3-9-19-17-8-12-20-11-6-16(17)14-20/h1-2,4-5,16-17,19H,3,6-14H2 |
| InChIKey | VPWNPHHTQUOZHN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|