C16H24N2S — CID 79942253
N-[3-(2,3-dihydroindol-1-yl)propyl]-5-methylthiolan-3-amine (PubChem CID 79942253) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)propyl]-5-methylthiolan-3-amine.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-5-methylthiolan-3-amine |
|---|---|
| PubChem CID | 79942253 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-5-methylthiolan-3-amine |
| SMILES | CC1CC(NCCCN2CCc3ccccc32)CS1 |
| InChI | InChI=1S/C16H24N2S/c1-13-11-15(12-19-13)17-8-4-9-18-10-7-14-5-2-3-6-16(14)18/h2-3,5-6,13,15,17H,4,7-12H2,1H3 |
| InChIKey | XOEGKORCCJDUOK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|