C15H22N2 — CID 55024431
N-[2-(2,3-dihydroindol-1-yl)ethyl]cyclopentanamine (PubChem CID 55024431) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-yl)ethyl]cyclopentanamine.
| Compound Name | N-[2-(2,3-dihydroindol-1-yl)ethyl]cyclopentanamine |
|---|---|
| PubChem CID | 55024431 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-yl)ethyl]cyclopentanamine |
| SMILES | c1ccc2c(c1)CCN2CCNC1CCCC1 |
| InChI | InChI=1S/C15H22N2/c1-4-8-15-13(5-1)9-11-17(15)12-10-16-14-6-2-3-7-14/h1,4-5,8,14,16H,2-3,6-7,9-12H2 |
| InChIKey | PVJZZGOGPZORRE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |