C16H24N2 — CID 54806650
1-[2-(azepan-1-yl)ethyl]-2,3-dihydroindole (PubChem CID 54806650) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)ethyl]-2,3-dihydroindole.
| Compound Name | 1-[2-(azepan-1-yl)ethyl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 54806650 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1-[2-(azepan-1-yl)ethyl]-2,3-dihydroindole |
| SMILES | c1ccc2c(c1)CCN2CCN1CCCCCC1 |
| InChI | InChI=1S/C16H24N2/c1-2-6-11-17(10-5-1)13-14-18-12-9-15-7-3-4-8-16(15)18/h3-4,7-8H,1-2,5-6,9-14H2 |
| InChIKey | HIWUVGBJBIQWHI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |