C14H21N3 — CID 28704454
1-(2-piperazin-1-ylethyl)-2,3-dihydroindole (PubChem CID 28704454) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-(2-piperazin-1-ylethyl)-2,3-dihydroindole.
| Compound Name | 1-(2-piperazin-1-ylethyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 28704454 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 1-(2-piperazin-1-ylethyl)-2,3-dihydroindole |
| SMILES | c1ccc2c(c1)CCN2CCN1CCNCC1 |
| InChI | InChI=1S/C14H21N3/c1-2-4-14-13(3-1)5-8-17(14)12-11-16-9-6-15-7-10-16/h1-4,15H,5-12H2 |
| InChIKey | KMFSDSVXIVMPNF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |