C18H28N2S — CID 79954468
N-[3-(2,3-dihydroindol-1-yl)propyl]-4,4-dimethylthian-3-amine (PubChem CID 79954468) has the molecular formula C18H28N2S and a molecular weight of 304.50 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)propyl]-4,4-dimethylthian-3-amine.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-4,4-dimethylthian-3-amine |
|---|---|
| PubChem CID | 79954468 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-4,4-dimethylthian-3-amine |
| SMILES | CC1(C)CCSCC1NCCCN1CCc2ccccc21 |
| InChI | InChI=1S/C18H28N2S/c1-18(2)9-13-21-14-17(18)19-10-5-11-20-12-8-15-6-3-4-7-16(15)20/h3-4,6-7,17,19H,5,8-14H2,1-2H3 |
| InChIKey | LAYOMHJIPYLTAY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|