C18H21N3S — CID 100678118
1-[3-(2,3-dihydroindol-1-yl)propyl]-3-phenylthiourea (PubChem CID 100678118) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 1-[3-(2,3-dihydroindol-1-yl)propyl]-3-phenylthiourea.
| Compound Name | 1-[3-(2,3-dihydroindol-1-yl)propyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 100678118 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 1-[3-(2,3-dihydroindol-1-yl)propyl]-3-phenylthiourea |
| SMILES | S=C(NCCCN1CCc2ccccc21)Nc1ccccc1 |
| InChI | InChI=1S/C18H21N3S/c22-18(20-16-8-2-1-3-9-16)19-12-6-13-21-14-11-15-7-4-5-10-17(15)21/h1-5,7-10H,6,11-14H2,(H2,19,20,22) |
| InChIKey | SCVXPJMQWSDXJP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_urea_A(12)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|