C19H19ClF3N3S — CID 100678642
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-(2,3-dihydroindol-1-yl)propyl]thiourea (PubChem CID 100678642) has the molecular formula C19H19ClF3N3S and a molecular weight of 413.90 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-(2,3-dihydroindol-1-yl)propyl]thiourea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-(2,3-dihydroindol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 100678642 |
| Molecular Formula | C19H19ClF3N3S |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[3-(2,3-dihydroindol-1-yl)propyl]thiourea |
| SMILES | FC(F)(F)c1cc(NC(=S)NCCCN2CCc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C19H19ClF3N3S/c20-16-7-6-14(12-15(16)19(21,22)23)25-18(27)24-9-3-10-26-11-8-13-4-1-2-5-17(13)26/h1-2,4-7,12H,3,8-11H2,(H2,24,25,27) |
| InChIKey | JWSNPYRYDSKTRX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_urea_A(12)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|