C27H27ClF3N3O3S — CID 43895066
2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[3-(2,3-dihydroindol-1-yl)propyl]acetamide (PubChem CID 43895066) has the molecular formula C27H27ClF3N3O3S and a molecular weight of 566.05 g/mol. Its IUPAC name is 2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[3-(2,3-dihydroindol-1-yl)propyl]acetamide.
| Compound Name | 2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[3-(2,3-dihydroindol-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 43895066 |
| Molecular Formula | C27H27ClF3N3O3S |
| Molecular Weight | 566.05 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | 2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[3-(2,3-dihydroindol-1-yl)propyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCCN2CCc3ccccc32)c2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C27H27ClF3N3O3S/c1-19-7-10-22(11-8-19)38(36,37)34(21-9-12-24(28)23(17-21)27(29,30)31)18-26(35)32-14-4-15-33-16-13-20-5-2-3-6-25(20)33/h2-3,5-12,17H,4,13-16,18H2,1H3,(H,32,35) |
| InChIKey | CPODCKWULNAYRL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.05 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|