C24H26ClF3N2O3S — CID 126031781
2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[2-(cyclohexen-1-yl)ethyl]acetamide (PubChem CID 126031781) has the molecular formula C24H26ClF3N2O3S and a molecular weight of 515.00 g/mol. Its IUPAC name is 2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[2-(cyclohexen-1-yl)ethyl]acetamide.
| Compound Name | 2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 126031781 |
| Molecular Formula | C24H26ClF3N2O3S |
| Molecular Weight | 515.00 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCC2=CCCCC2)c2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H26ClF3N2O3S/c1-17-7-10-20(11-8-17)34(32,33)30(19-9-12-22(25)21(15-19)24(26,27)28)16-23(31)29-14-13-18-5-3-2-4-6-18/h5,7-12,15H,2-4,6,13-14,16H2,1H3,(H,29,31) |
| InChIKey | NNCVZDPYXRKSTI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.00 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|