C27H30ClN3O4S — CID 30217141
2-(3-chloro-4-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[3-(2,3-dihydroindol-1-yl)propyl]acetamide (PubChem CID 30217141) has the molecular formula C27H30ClN3O4S and a molecular weight of 528.07 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[3-(2,3-dihydroindol-1-yl)propyl]acetamide.
| Compound Name | 2-(3-chloro-4-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[3-(2,3-dihydroindol-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 30217141 |
| Molecular Formula | C27H30ClN3O4S |
| Molecular Weight | 528.07 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 2-(3-chloro-4-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[3-(2,3-dihydroindol-1-yl)propyl]acetamide |
| SMILES | COc1ccc(N(CC(=O)NCCCN2CCc3ccccc32)S(=O)(=O)c2ccc(C)cc2)cc1Cl |
| InChI | InChI=1S/C27H30ClN3O4S/c1-20-8-11-23(12-9-20)36(33,34)31(22-10-13-26(35-2)24(28)18-22)19-27(32)29-15-5-16-30-17-14-21-6-3-4-7-25(21)30/h3-4,6-13,18H,5,14-17,19H2,1-2H3,(H,29,32) |
| InChIKey | QXEXCNHPSNVVSN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.07 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|