C20H23N3O2S — CID 100741827
1-(1,3-benzodioxol-5-yl)-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]thiourea (PubChem CID 100741827) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 100741827 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]thiourea |
| SMILES | S=C(NCCCN1CCCc2ccccc21)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H23N3O2S/c26-20(22-16-8-9-18-19(13-16)25-14-24-18)21-10-4-12-23-11-3-6-15-5-1-2-7-17(15)23/h1-2,5,7-9,13H,3-4,6,10-12,14H2,(H2,21,22,26) |
| InChIKey | IPLHVTUANRACNS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_A(12)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|