C22H27N3O2S — CID 100742115
ethyl 3-[3-(3,4-dihydro-2H-quinolin-1-yl)propylcarbamothioylamino]benzoate (PubChem CID 100742115) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is ethyl 3-[3-(3,4-dihydro-2H-quinolin-1-yl)propylcarbamothioylamino]benzoate.
| Compound Name | ethyl 3-[3-(3,4-dihydro-2H-quinolin-1-yl)propylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100742115 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | ethyl 3-[3-(3,4-dihydro-2H-quinolin-1-yl)propylcarbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)NCCCN2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C22H27N3O2S/c1-2-27-21(26)18-9-5-11-19(16-18)24-22(28)23-13-7-15-25-14-6-10-17-8-3-4-12-20(17)25/h3-5,8-9,11-12,16H,2,6-7,10,13-15H2,1H3,(H2,23,24,28) |
| InChIKey | BVIDIKKFSOQLER-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_A(12)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|