C16H20N4O2S — CID 100665007
ethyl 3-(3-imidazol-1-ylpropylcarbamothioylamino)benzoate (PubChem CID 100665007) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is ethyl 3-(3-imidazol-1-ylpropylcarbamothioylamino)benzoate.
| Compound Name | ethyl 3-(3-imidazol-1-ylpropylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 100665007 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | ethyl 3-(3-imidazol-1-ylpropylcarbamothioylamino)benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)NCCCn2ccnc2)c1 |
| InChI | InChI=1S/C16H20N4O2S/c1-2-22-15(21)13-5-3-6-14(11-13)19-16(23)18-7-4-9-20-10-8-17-12-20/h3,5-6,8,10-12H,2,4,7,9H2,1H3,(H2,18,19,23) |
| InChIKey | QRKIOZYJAARHCF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|