C15H20N4S — CID 4506024
1-(3,5-dimethylphenyl)-3-(3-imidazol-1-ylpropyl)thiourea (PubChem CID 4506024) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-(3-imidazol-1-ylpropyl)thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-(3-imidazol-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 4506024 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-(3-imidazol-1-ylpropyl)thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)NCCCn2ccnc2)c1 |
| InChI | InChI=1S/C15H20N4S/c1-12-8-13(2)10-14(9-12)18-15(20)17-4-3-6-19-7-5-16-11-19/h5,7-11H,3-4,6H2,1-2H3,(H2,17,18,20) |
| InChIKey | BYJZAAOMADSLOV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|