C14H18N4S2 — CID 6539187
1-(3-imidazol-1-ylpropyl)-3-(4-methylsulfanylphenyl)thiourea (PubChem CID 6539187) has the molecular formula C14H18N4S2 and a molecular weight of 306.46 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-3-(4-methylsulfanylphenyl)thiourea.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-3-(4-methylsulfanylphenyl)thiourea |
|---|---|
| PubChem CID | 6539187 |
| Molecular Formula | C14H18N4S2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-3-(4-methylsulfanylphenyl)thiourea |
| SMILES | CSc1ccc(NC(=S)NCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C14H18N4S2/c1-20-13-5-3-12(4-6-13)17-14(19)16-7-2-9-18-10-8-15-11-18/h3-6,8,10-11H,2,7,9H2,1H3,(H2,16,17,19) |
| InChIKey | NORWENIARPWRKO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|