C12H14N4S — CID 115570770
1-(2-imidazol-1-ylethyl)-3-phenylthiourea (PubChem CID 115570770) has the molecular formula C12H14N4S and a molecular weight of 246.34 g/mol. Its IUPAC name is 1-(2-imidazol-1-ylethyl)-3-phenylthiourea.
| Compound Name | 1-(2-imidazol-1-ylethyl)-3-phenylthiourea |
|---|---|
| PubChem CID | 115570770 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1-(2-imidazol-1-ylethyl)-3-phenylthiourea |
| SMILES | S=C(NCCn1ccnc1)Nc1ccccc1 |
| InChI | InChI=1S/C12H14N4S/c17-12(15-11-4-2-1-3-5-11)14-7-9-16-8-6-13-10-16/h1-6,8,10H,7,9H2,(H2,14,15,17) |
| InChIKey | XYIYEAHCROQYIR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|