C26H35N5O4S2 — CID 145463609
1-(3,4-dimethoxyphenyl)-3-(3-imidazol-1-ylpropyl)thiourea;ethane;4-isothiocyanato-1,2-dimethoxybenzene (PubChem CID 145463609) has the molecular formula C26H35N5O4S2 and a molecular weight of 545.73 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(3-imidazol-1-ylpropyl)thiourea;ethane;4-isothiocyanato-1,2-dimethoxybenzene.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(3-imidazol-1-ylpropyl)thiourea;ethane;4-isothiocyanato-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 145463609 |
| Molecular Formula | C26H35N5O4S2 |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(3-imidazol-1-ylpropyl)thiourea;ethane;4-isothiocyanato-1,2-dimethoxybenzene |
| SMILES | CC.COc1ccc(N=C=S)cc1OC.COc1ccc(NC(=S)NCCCn2ccnc2)cc1OC |
| InChI | InChI=1S/C15H20N4O2S.C9H9NO2S.C2H6/c1-20-13-5-4-12(10-14(13)21-2)18-15(22)17-6-3-8-19-9-7-16-11-19;1-11-8-4-3-7(10-6-13)5-9(8)12-2;1-2/h4-5,7,9-11H,3,6,8H2,1-2H3,(H2,17,18,22);3-5H,1-2H3;1-2H3 |
| InChIKey | JDQTYYWBRRSKJD-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|