C20H28N4O3 — CID 165177168
N-(3,4-dimethoxyphenyl)-1-(3-imidazol-1-ylpropylamino)cyclopentane-1-carboxamide (PubChem CID 165177168) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-1-(3-imidazol-1-ylpropylamino)cyclopentane-1-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-1-(3-imidazol-1-ylpropylamino)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 165177168 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-1-(3-imidazol-1-ylpropylamino)cyclopentane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(NCCCn3ccnc3)CCCC2)cc1OC |
| InChI | InChI=1S/C20H28N4O3/c1-26-17-7-6-16(14-18(17)27-2)23-19(25)20(8-3-4-9-20)22-10-5-12-24-13-11-21-15-24/h6-7,11,13-15,22H,3-5,8-10,12H2,1-2H3,(H,23,25) |
| InChIKey | WDXHJZKKBLAFLI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|