C15H18N2O3 — CID 139771562
ethyl 3-(3-imidazol-1-ylpropoxy)benzoate (PubChem CID 139771562) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl 3-(3-imidazol-1-ylpropoxy)benzoate.
| Compound Name | ethyl 3-(3-imidazol-1-ylpropoxy)benzoate |
|---|---|
| PubChem CID | 139771562 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | ethyl 3-(3-imidazol-1-ylpropoxy)benzoate |
| SMILES | CCOC(=O)c1cccc(OCCCn2ccnc2)c1 |
| InChI | InChI=1S/C15H18N2O3/c1-2-19-15(18)13-5-3-6-14(11-13)20-10-4-8-17-9-7-16-12-17/h3,5-7,9,11-12H,2,4,8,10H2,1H3 |
| InChIKey | CJAOCRREGXEPAR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|