C14H17N3O3 — CID 61493245
3-imidazol-1-ylpropyl 2-(3-aminophenoxy)acetate (PubChem CID 61493245) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-imidazol-1-ylpropyl 2-(3-aminophenoxy)acetate.
| Compound Name | 3-imidazol-1-ylpropyl 2-(3-aminophenoxy)acetate |
|---|---|
| PubChem CID | 61493245 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-imidazol-1-ylpropyl 2-(3-aminophenoxy)acetate |
| SMILES | Nc1cccc(OCC(=O)OCCCn2ccnc2)c1 |
| InChI | InChI=1S/C14H17N3O3/c15-12-3-1-4-13(9-12)20-10-14(18)19-8-2-6-17-7-5-16-11-17/h1,3-5,7,9,11H,2,6,8,10,15H2 |
| InChIKey | DKCHDFSGNNECDM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|