C12H14N2O2 — CID 61492833
3-(3-imidazol-1-ylpropoxy)phenol (PubChem CID 61492833) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-(3-imidazol-1-ylpropoxy)phenol.
| Compound Name | 3-(3-imidazol-1-ylpropoxy)phenol |
|---|---|
| PubChem CID | 61492833 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-(3-imidazol-1-ylpropoxy)phenol |
| SMILES | Oc1cccc(OCCCn2ccnc2)c1 |
| InChI | InChI=1S/C12H14N2O2/c15-11-3-1-4-12(9-11)16-8-2-6-14-7-5-13-10-14/h1,3-5,7,9-10,15H,2,6,8H2 |
| InChIKey | DLHLQGBJOVMBSI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|