C22H32N2O4 — CID 14327319
6-[3-(5-imidazol-1-ylpentoxy)phenoxy]-2,2-dimethylhexanoic acid (PubChem CID 14327319) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 6-[3-(5-imidazol-1-ylpentoxy)phenoxy]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[3-(5-imidazol-1-ylpentoxy)phenoxy]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 14327319 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 6-[3-(5-imidazol-1-ylpentoxy)phenoxy]-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CCCCOc1cccc(OCCCCCn2ccnc2)c1)C(=O)O |
| InChI | InChI=1S/C22H32N2O4/c1-22(2,21(25)26)11-4-7-16-28-20-10-8-9-19(17-20)27-15-6-3-5-13-24-14-12-23-18-24/h8-10,12,14,17-18H,3-7,11,13,15-16H2,1-2H3,(H,25,26) |
| InChIKey | BSEZQOWCMRVJQA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|