C21H29N3O4 — CID 13422045
6-[4-(4-imidazol-1-ylbutanoylamino)phenoxy]-2,2-dimethylhexanoic acid (PubChem CID 13422045) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 6-[4-(4-imidazol-1-ylbutanoylamino)phenoxy]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[4-(4-imidazol-1-ylbutanoylamino)phenoxy]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 13422045 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 6-[4-(4-imidazol-1-ylbutanoylamino)phenoxy]-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CCCCOc1ccc(NC(=O)CCCn2ccnc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H29N3O4/c1-21(2,20(26)27)11-3-4-15-28-18-9-7-17(8-10-18)23-19(25)6-5-13-24-14-12-22-16-24/h7-10,12,14,16H,3-6,11,13,15H2,1-2H3,(H,23,25)(H,26,27) |
| InChIKey | JZGOXVTTZLMAEI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|