C13H15F3O3 — CID 70828760
ethyl 3-(4,4,4-trifluorobutoxy)benzoate (PubChem CID 70828760) has the molecular formula C13H15F3O3 and a molecular weight of 276.25 g/mol. Its IUPAC name is ethyl 3-(4,4,4-trifluorobutoxy)benzoate.
| Compound Name | ethyl 3-(4,4,4-trifluorobutoxy)benzoate |
|---|---|
| PubChem CID | 70828760 |
| Molecular Formula | C13H15F3O3 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | ethyl 3-(4,4,4-trifluorobutoxy)benzoate |
| SMILES | CCOC(=O)c1cccc(OCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3O3/c1-2-18-12(17)10-5-3-6-11(9-10)19-8-4-7-13(14,15)16/h3,5-6,9H,2,4,7-8H2,1H3 |
| InChIKey | XGTGDPZBHPKGMD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|