C18H26N2O2S2 — CID 100602892
ethyl 3-(2-cyclohexylsulfanylethylcarbamothioylamino)benzoate (PubChem CID 100602892) has the molecular formula C18H26N2O2S2 and a molecular weight of 366.55 g/mol. Its IUPAC name is ethyl 3-(2-cyclohexylsulfanylethylcarbamothioylamino)benzoate.
| Compound Name | ethyl 3-(2-cyclohexylsulfanylethylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 100602892 |
| Molecular Formula | C18H26N2O2S2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | ethyl 3-(2-cyclohexylsulfanylethylcarbamothioylamino)benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)NCCSC2CCCCC2)c1 |
| InChI | InChI=1S/C18H26N2O2S2/c1-2-22-17(21)14-7-6-8-15(13-14)20-18(23)19-11-12-24-16-9-4-3-5-10-16/h6-8,13,16H,2-5,9-12H2,1H3,(H2,19,20,23) |
| InChIKey | NHUYDMIYCZQHPS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|